| 1 |
1,10-phenanthroline
(738 times)
|
Chemistry
(345 times)
|
bpy (139 times)
bipy (88 times)
dpq (31 times)
|
1977 Ternary copper (II) complexes containing salicylate and nitrogenous chelates such as histamine.
|
| 2 |
phosphatase inhibitor bpV
(11 times)
|
Biochemistry
(3 times)
|
c-Src (1 time)
cAMP (1 time)
ECC (1 time)
|
1999 Phorbol ester reduces phosphorylation of epidermal growth factor receptor in pancreatic cancer cells by activation of a tyrosine phosphatase.
|
| 3 |
Copper-1,10-phenanthroline
(7 times)
|
Biochemistry
(2 times)
|
bpy (1 time)
CS (1 time)
DFT (1 time)
|
2005 Spectrophotometric determination of ascorbic acid using copper(II)-neocuproine reagent in beverages and pharmaceuticals.
|
| 4 |
PTEN inhibitor bpV
(7 times)
|
Science
(2 times)
|
PTEN (2 times)
ALI (1 time)
EC (1 time)
|
2000 Tyrosine phosphorylation of p97 regulates transitional endoplasmic reticulum assembly in vitro.
|
| 5 |
1,10-phenanthroline monohydrate
(4 times)
|
Chemistry Techniques, Analytical
(2 times)
|
bipy (1 time)
BPEA (1 time)
Dipy (1 time)
|
1995 Synergic solvent extraction studies of gadolinium using a combination of the di(2-ethylhexyl)phosphoric acid and three adductants into kerosine/chloroform.
|
| 6 |
fullerene-porphyrin-Cu
(2 times)
|
Biochemistry
(1 time)
|
HETPHEN (1 time)
|
2007 Synthesis of supramolecular fullerene-porphyrin-Cu(phen)(2)-ferrocene architectures. A heteroleptic approach towards tetrads.
|
| 7 |
phosphatase inhibitors sodium orthovanadate and bpV
(2 times)
|
Biochemistry
(1 time)
|
MAPK (1 time)
PM (1 time)
SHP-2 (1 time)
|
2004 Adenosine acts through A2 receptors to inhibit IL-2-induced tyrosine phosphorylation of STAT5 in T lymphocytes: role of cyclic adenosine 3',5'-monophosphate and phosphatases.
|
| 8 |
PTEN with bpV
(2 times)
|
Medicine
(1 time)
|
ENS (1 time)
NPCs (1 time)
|
2013 Ex vivo neurogenesis within enteric ganglia occurs in a PTEN dependent manner.
|
| 9 |
1,10-phenanthroline (phen) ligands; Fe
(1 time)
|
Biology
(1 time)
|
TOFs (1 time)
TONs (1 time)
|
2019 An Unexpected Iron (II)-Based Homogeneous Catalytic System for Highly Efficient CO2-to-CO Conversion under Visible-Light Irradiation.
|
| 10 |
1,10-phenanthroline (phen) of fac-Re
(1 time)
|
Chemistry
(1 time)
|
BIH (1 time)
|
2020 Photocatalytic CO2 Reduction Mediated by Electron Transfer via the Excited Triplet State of Zn(II) Porphyrin.
|
| 11 |
1,10-phenanthroline complexes of ruthenium, Ru
(1 time)
|
Science
(1 time)
|
---
|
1988 Accelerated electron transfer between metal complexes mediated by DNA.
|
| 12 |
1,10-phenanthroline ligand
(1 time)
|
Crystallography
(1 time)
|
---
|
2012 catena-Poly[[[diaqua-(1,10-phenanthroline-kappa(2) N,N')cobalt(II)]-mu-1H-benzimidazole-5,6-dicarboxyl-ato-kappa(2) N (3):O (6)] sesquihydrate}.
|
| 13 |
1,10-phenanthroline, and Ad-tripod-bpy
(1 time)
|
Chemistry
(1 time)
|
---
|
2002 Long-range electron transfer across molecule-nanocrystalline semiconductor interfaces using tripodal sensitizers.
|
| 14 |
1,10-phenantroline, originating the reddish orange Fe
(1 time)
|
Chemistry
(1 time)
|
---
|
2000 Flow injection spectrophotometric determination of ascorbic acid in soft drinks and beer.
|
| 15 |
2,9-diaryl-1,10-phenanthroline
(1 time)
|
Chemistry
(1 time)
|
---
|
2008 General method for synthesis of functionalized macrocycles and catenanes utilizing "click" chemistry.
|
| 16 |
3-phosphatase activity, sodium vanadate or a cell permeable derivative, bpV
(1 time)
|
Biochemistry
(1 time)
|
---
|
2007 The control of phosphatidylinositol 3,4-bisphosphate concentrations by activation of the Src homology 2 domain containing inositol polyphosphate 5-phosphatase 2, SHIP2.
|
| 17 |
5'-pyr-pyr-pur-3' sites within the acceptor and anticodon stems of tDNA;Rh
(1 time)
|
Biochemistry
(1 time)
|
---
|
1993 Chemical probing of tDNAPhe with transition metal complexes: a structural comparison of RNA and DNA.
|
| 18 |
7-(p-anisyl)-1,10-phenanthroline
(1 time)
|
Chemistry
(1 time)
|
---
|
2001 Octahedral Fe(II) and Ru(II) complexes based on a new bis 1,10-phenanthroline ligand that imposes a well defined axis.
|
| 19 |
8-methoxy-psoralen and the delta and lambda enantiomers of Ru
(1 time)
|
Biochemistry
(1 time)
|
DAPI (1 time)
|
1994 Interactions of DNA binding ligands with PNA-DNA hybrids.
|
| 20 |
9,10-phenanthrenequinone
(1 time)
|
Chemistry
(1 time)
|
acen (1 time)
FN (1 time)
pfb (1 time)
|
2017 Bulky Ytterbium Formamidinates Stabilise Complexes with Radical Ligands, and Related Samarium "Tetracyclone" Chemistry.
|
| 21 |
acetonitrile-1,10-phenanthroline
(1 time)
|
Biochemistry
(1 time)
|
ECL (1 time)
FTIR (1 time)
GC-MS (1 time)
|
2006 Cathodic electrochemiluminescence of acetonitrile, acetonitrile-1,10-phenanthroline and acetonitrile-ternary Eu(III) complexes at a gold electrode.
|
| 22 |
bis(1,10-phenanthroline)(4-chloro-1,10-phenanthroline)ruthenium(II), due to the combination of two strong-field chelating ligands
(1 time)
|
Polymers
(1 time)
|
---
|
2018 Optimization of Temperature Sensing with Polymer-Embedded Luminescent Ru(II) Complexes.
|
| 23 |
Copper-1,10-phenanthroline (phen) complexes Cu
(1 time)
|
Chemistry
(1 time)
|
DFT (1 time)
MD (1 time)
|
2009 Copper-1,10-phenanthroline complexes binding to DNA: structural predictions from molecular simulations.
|
| 24 |
ortho-phenanthroline
(1 time)
|
Chemistry Techniques, Analytical
(1 time)
|
DTPA (1 time)
EDTA (1 time)
Tris (1 time)
|
2004 Speciation of V, Cr and Fe by capillary electrophoresis-bandpass reaction cell inductively coupled plasma mass spectrometry.
|
| 25 |
parameters on which the binding of Ru
(1 time)
|
Molecular Biology
(1 time)
|
---
|
2008 Stopped-flow kinetic fluorimetric studies of the interaction of Ru(II) complex with DNA and its analytical application.
|
| 26 |
parameters, the series of solid solutions of general formula
(1 time)
|
Chemistry
(1 time)
|
VT (1 time)
|
2020 Photo- and Thermosensitive Molecular Crystals. Valence Tautomeric Interconversion as the Cause of the Photomechanical Effect in Crystals of Bis(dioxolene)cobalt Complex.
|
| 27 |
part at FO achieves the introduction of Ru
(1 time)
|
Biotechnology
(1 time)
|
ECL (1 time)
FO (1 time)
GO (1 time)
|
2013 An electrochemiluminescence aptasensor for thrombin using graphene oxide to immobilize the aptamer and the intercalated [Formula: see text] probe.
|
| 28 |
partial double strand section in the aptamer, where Ru
(1 time)
|
Chemistry
(1 time)
|
---
|
2011 Analyte-induced formation of partial duplexes for the preparation of a label-free electrochemiluminescent aptasensor.
|
| 29 |
partially inhibited the GS activation induced by bpV
(1 time)
|
Biochemistry
(1 time)
|
GS (1 time)
GSK-3 (1 time)
|
1999 Regulation of glycogen synthase in rat hepatocytes. Evidence for multiple signaling pathways.
|
| 30 |
particularly the higher-order component, reflect an interaction specific to Fe
(1 time)
|
Chemistry
(1 time)
|
---
|
2006 Kinetics of the reaction of chromium(VI) with tris(1,10-phenanthroline)iron(II) ions in acidic solutions. Anion and medium effects: perchlorate versus triflate.
|
| 31 |
pay attention to the roles of bpV
(1 time)
|
Biochemistry
(1 time)
|
HDAC6 (1 time)
LC3 (1 time)
|
2015 Potassium Bisperoxo(1,10-phenanthroline)oxovanadate (bpV(phen)) Induces Apoptosis and Pyroptosis and Disrupts the P62-HDAC6 Protein Interaction to Suppress the Acetylated Microtubule-dependent Degradation of Autophagosomes.
|
| 32 |
Pd(5-NH(2)-phen)(2)(NO(3))(2) (2) and Pd
(1 time)
|
Chemistry
(1 time)
|
---
|
2009 Cytotoxicity and effects of 1,10-phenanthroline and 5-amino-1,10-phenanthroline derivatives on some immunocompetent cells.
|
| 33 |
Pd(5-NH(2)-phen)(2)(NO(3))(2) and the protonated dimer
(1 time)
|
Chemistry
(1 time)
|
---
|
2009 Antitumour activity of novel 1,10-phenanthroline and 5-amino-1,10-phenanthroline derivatives.
|
| 34 |
peptide-Cu(II)-1,10-phenanthroline
(1 time)
|
Biochemistry
(1 time)
|
---
|
2003 Synthesis, structure and nuclease properties of several ternary copper(II) peptide complexes with 1,10-phenanthroline.
|
| 35 |
performance of the device with Zn
(1 time)
|
Nanotechnology
(1 time)
|
EA (1 time)
IP (1 time)
|
2014 White organic light-emitting diodes with Zn-complexes.
|
| 36 |
performance was obtained when both f
(1 time)
|
Environmental Health
(1 time)
|
---
|
2008 Sensitivity analysis of a parameterization of the stomatal component of the DO3SE model for Quercus ilex to estimate ozone fluxes.
|
| 37 |
performed to study the spin-crossover transition of Fe
(1 time)
|
Biophysics
(1 time)
|
---
|
2012 Spin crossover transition of Fe(phen)2(NCS)2: periodic dispersion-corrected density-functional study.
|
| 38 |
PF(6))xH(2)O (where M=Co(III) or Ni(II), L=1,10-phenanthroline
(1 time)
|
Molecular Biology
(1 time)
|
bpy (1 time)
|
2013 Synthesis, antimicrobial, DNA-binding and photonuclease studies of cobalt(III) and nickel(II) Schiff base complexes.
|
| 39 |
pH-dependent manner in the VO
(1 time)
|
Biochemistry
(1 time)
|
---
|
1995 Mechanism for a new antitumor vanadium complex: hydroxyl radical-dependent DNA cleavage by 1,10-phenanthroline-vanadyl complex in the presence of hydrogen peroxide.
|
| 40 |
phen dimer
(1 time)
|
Chemistry
(1 time)
|
STM (1 time)
|
2005 Investigation of the scanning tunneling microscopy image, the stacking pattern, and the bias-voltage-dependent structural instability of 1,10'-phenanthroline molecules adsorbed on Au(111) in terms of electronic structure calculations.
|
| 41 |
phen is significantly reduced in Cp*Rh
(1 time)
|
Chemistry
(1 time)
|
---
|
2017 Structural and Electrochemical Consequences of [Cp*] Ligand Protonation.
|
| 42 |
phen-based drug candidates of the formulation Co
(1 time)
|
Biochemistry
(1 time)
|
CA (1 time)
MN (1 time)
MNPCE (1 time)
|
2019 Evaluation of cytotoxic activity and genotoxicity of structurally well characterized potent cobalt(II) phen-based antitumor drug entities: An in vitro and in vivo approach.
|
| 43 |
phenanthroline complex
(1 time)
|
Biochemistry
(1 time)
|
---
|
2001 Cyclization/hydrosilylation of functionalized diynes catalyzed by a cationic platinum phenanthroline complex.
|
| 44 |
phenanthroline increased passive penetration of bpV
(1 time)
|
Drug Therapy
(1 time)
|
---
|
2000 A combination of iontophoresis and the chelating agent 1,10 phenanthroline act synergistically as penetration enhancers.
|
| 45 |
phenanthroline protons of Rh
(1 time)
|
Biochemistry
(1 time)
|
TMe (1 time)
|
1990 1H NMR studies of tris(phenanthroline) metal complexes bound to oligonucleotides: characterization of binding modes.
|
| 46 |
phenanthroline unit
(1 time)
|
Chemistry
(1 time)
|
His (1 time)
|
2016 Copper(II) Complexes of Phenanthroline and Histidine Containing Ligands: Synthesis, Characterization and Evaluation of their DNA Cleavage and Cytotoxic Activity.
|
| 47 |
phenanthroline-ligated perfluoroalkyl copper reagents
(1 time)
|
Biochemistry
(1 time)
|
---
|
2014 Copper-mediated perfluoroalkylation of heteroaryl bromides with (phen)CuRF.
|
| 48 |
phenanthrolyl
(1 time)
|
Chemistry
(1 time)
|
bipy (1 time)
|
2019 The 1,10-Phenanthroline Ligand Enhances the Antiproliferative Activity of DNA-Intercalating Thiourea-Pd(II) and -Pt(II) Complexes Against Cisplatin-Sensitive and -Resistant Human Ovarian Cancer Cell Lines.
|
| 49 |
phenol Kd
(1 time)
|
Environmental Health
(1 time)
|
BTMA (1 time)
PTMA (1 time)
|
2009 Unexpected difference in phenol sorption on PTMA- and BTMA-bentonite.
|
| 50 |
phenolate anion Kd
(1 time)
|
Environmental Health
(1 time)
|
BTMA (1 time)
PTMA (1 time)
|
2009 Unexpected difference in phenol sorption on PTMA- and BTMA-bentonite.
|
| 51 |
phenomena studied using Fe
(1 time)
|
Chemistry
(1 time)
|
phenO (1 time)
|
2010 Central role of phenanthroline mono-N-oxide in the decomposition reactions of tris(1,10-phenanthroline)iron(II) and -iron(III) complexes.
|
| 52 |
Phenylarsine oxide and neomycin significantly decrease bpV
(1 time)
|
Gynecology
(1 time)
|
PLC-gamma1 (1 time)
|
2007 The role of phospholipase Cgamma1 tyrosine phosphorylation during phasic myometrial contractions.
|
| 53 |
phenylephrine or hemorrhage was paralleled by an increase in Ru
(1 time)
|
Gastroenterology
(1 time)
|
---
|
2004 High-resolution visualization of oxygen distribution in the liver in vivo.
|
| 54 |
phosphatidylinositol 3'-kinase was induced by bpV
(1 time)
|
Endocrinology
(1 time)
|
HTC-IR (1 time)
IRK (1 time)
PTP (1 time)
|
1997 Early signaling events triggered by peroxovanadium [bpV(phen)] are insulin receptor kinase (IRK)-dependent: specificity of inhibition of IRK-associated protein tyrosine phosphatase(s) by bpV(phen).
|
| 55 |
phosphatidyloinositol 3'-kinase and p70s6k, is activated by bpV
(1 time)
|
Biochemistry
(1 time)
|
IGFBP (1 time)
MAP (1 time)
MEK (1 time)
|
1997 Phosphatidylinositol 3'-kinase and p70s6k are required for insulin but not bisperoxovanadium 1,10-phenanthroline (bpV(phen)) inhibition of insulin-like growth factor binding protein gene expression. Evidence for MEK-independent activation of mitogen-activated protein kinase by bpV(phen).
|
| 56 |
phosphoranyl-1,2,3-triazolate (L(-)), LnL(3).nH(2)O (1-8) and LnL(3)
(1 time)
|
Chemistry
(1 time)
|
DMSO (1 time)
|
2010 Lanthanide(III) complexes with 4,5-bis(diphenylphosphinoyl)-1,2,3-triazolate and the use of 1,10-phenanthroline as auxiliary ligand.
|
| 57 |
Phosphorylase activity was unaffected by GF or bpV
(1 time)
|
Endocrinology
(1 time)
|
GF (1 time)
GS-I (1 time)
|
2002 Glucose transport rate and glycogen synthase activity both limit skeletal muscle glycogen accumulation.
|
| 58 |
phosphorylation did not increase beyond that seen with BpV
(1 time)
|
Chemistry
(1 time)
|
PLC (1 time)
|
2004 The tyrosine [correction of tryrosine] phosphorylation and cytoskeletal translocation of phospholipase C gamma 1 in bovine adrenal medullary chromaffin cells.
|
| 59 |
phosphotyrosine accumulation induced by pV
(1 time)
|
Biochemistry
(1 time)
|
BMOV (1 time)
PDTC (1 time)
PTP (1 time)
|
1997 Role of oxidative stress in the action of vanadium phosphotyrosine phosphatase inhibitors. Redox independent activation of NF-kappaB.
|
| 60 |
photoactive donors, Ru
(1 time)
|
Biology
(1 time)
|
phi (1 time)
|
2000 Luminescence quenching by DNA-bound viologens: effect of reactant identity on efficiency and dynamics of electron transfer in DNA.
|
| 61 |
Photochemically induced binding of Rh
(1 time)
|
Biochemistry
(1 time)
|
---
|
1989 Photochemically induced binding of Rh(phen)2Cl2+ to DNA.
|
| 62 |
photoconjugation of methylene blue and cis-Rh
(1 time)
|
Biochemistry
(1 time)
|
MB (1 time)
|
2000 Simultaneous photoconjugation of methylene blue and cis-Rh(phen)2Cl2+ to DNA via a synergistic effect.
|
| 63 |
photoelectrocatalytic oxidation system using Fe
(1 time)
|
Environmental Health
(1 time)
|
PEC (1 time)
|
2006 Determination of hydroxyl radicals in TiO2/Ti photoelectrocatalytic oxidation system using Fe(phen)3(2+) spectrophotometry.
|
| 64 |
Photoinduced cross-linking of RNA by cis-Rh
(1 time)
|
Biochemistry
(1 time)
|
---
|
1999 Photoinduced cross-linking of RNA by cis-Rh(phen)2Cl2+ and cis-Rh(phen)(phi)Cl2+: a new family of light activatable nucleic acid cross-linking agents.
|
| 65 |
Photoinduced Spin Crossover of Fe
(1 time)
|
Chemistry
(1 time)
|
MLCT (1 time)
XANES (1 time)
|
2019 Tracking the Metal-Centered Triplet in Photoinduced Spin Crossover of Fe(phen)32+ with Tabletop Femtosecond M-Edge X-ray Absorption Near-Edge Structure Spectroscopy.
|
| 66 |
photophysical measurements obtained for the benchmark fac-Re
(1 time)
|
Chemistry
(1 time)
|
MLCT (1 time)
RT (1 time)
TA (1 time)
|
2005 Influence of a gold(I)-Acetylide subunit on the photophysics of Re(phen)(CO)3Cl.
|
| 67 |
photophysics investigated in Fe
(1 time)
|
Chemistry
(1 time)
|
HS (1 time)
LS (1 time)
SCO (1 time)
|
2015 Ultrafast light-induced spin-state trapping photophysics investigated in Fe(phen)2(NCS)2 spin-crossover crystal.
|
| 68 |
photoreaction between the Ru
(1 time)
|
Biology
(1 time)
|
TrpH (1 time)
|
2017 Kinetics of photoinduced electron transfer reactions of ruthenium(II) complexes and phenols, tyrosine, N-acetyl-tyrosine and tryptophan in aqueous solutions measured with modulated fluorescence spectroscopy.
|
| 69 |
photoreaction of intercalated Ru
(1 time)
|
Biology
(1 time)
|
phi (1 time)
|
2000 Luminescence quenching by DNA-bound viologens: effect of reactant identity on efficiency and dynamics of electron transfer in DNA.
|
| 70 |
photostability and a longer fluorescence lifetime compared to free Ru
(1 time)
|
Chemistry
(1 time)
|
---
|
2005 Stober synthesis of monodispersed luminescent silica nanoparticles for bioanalytical assays.
|
| 71 |
played a major role in the formation of Cu
(1 time)
|
Environmental Health
(1 time)
|
BSA (1 time)
CD (1 time)
|
2008 Study on the interaction between Cu phen2+3 and bovine serum albumin by spectroscopic methods.
|
| 72 |
played major roles in stabilizing the Co
(1 time)
|
Environmental Health
(1 time)
|
BSA (1 time)
|
2010 Spectroscopic studies on the binding of cobalt(II) 1,10-phenanthroline complex to bovine serum albumin.
|
| 73 |
polymer which can embed numerous ECL indicator, Ru
(1 time)
|
Chemistry Techniques, Analytical
(1 time)
|
AP (1 time)
DNA-AuNPs (1 time)
ECL (1 time)
|
2019 Label-free and amplified electrogenerated chemiluminescence biosensing for the detection of thymine DNA glycosylase activity using DNA-functionalized gold nanoparticles triggered hybridization chain reaction.
|
| 74 |
polypyridyl ligands, with general formula ct-(RuCl(CO)(N-N)(dppf))PF6, N-N = 1,10-phenanthroline
(1 time)
|
Biochemistry
(1 time)
|
BSA (1 time)
CT-DNA (1 time)
dppz (1 time)
|
2018 Carbonyl-heterobimetallic Ru(II)/Fe(II)-complexes containing polypyridyl ligands: Synthesis, characterization, cellular viability assays and interactions with biomolecules.
|
| 75 |
positive entropy change for complexation of Ru
(1 time)
|
Chemistry
(1 time)
|
TMe-alpha-CD (1 time)
|
2001 Chiral recognition of helical metal complexes by modified cyclodextrins.
|
| 76 |
potent competitive inhibitor than pV
(1 time)
|
Biochemistry
(1 time)
|
ox (1 time)
pic (1 time)
|
2000 Effects of oxodiperoxovanadate (V) complexes on the activity of green crab (Scylla serrata) alkaline phosphatase.
|
| 77 |
potentials that disappeared after dorsal column transection. bpV
(1 time)
|
Neurology
(1 time)
|
---
|
2008 Small-molecule protein tyrosine phosphatase inhibition as a neuroprotective treatment after spinal cord injury in adult rats.
|
| 78 |
presence of catechol with the use of the Co
(1 time)
|
Chemistry Techniques, Analytical
(1 time)
|
AFM (1 time)
CV (1 time)
dsDNA (1 time)
|
2013 A novel dsDNA/polydiphenylamine-4-sulfonic acid electrochemical biosensor for selective detection of the toxic catechol and related DNA damage.
|
| 79 |
presence of Dex/Gluc, whereas in response to bpV
(1 time)
|
Biochemistry
(1 time)
|
IGFBP (1 time)
MAP (1 time)
MEK (1 time)
|
1997 Phosphatidylinositol 3'-kinase and p70s6k are required for insulin but not bisperoxovanadium 1,10-phenanthroline (bpV(phen)) inhibition of insulin-like growth factor binding protein gene expression. Evidence for MEK-independent activation of mitogen-activated protein kinase by bpV(phen).
|
| 80 |
presence of target cells, the capture DNA and Ru
(1 time)
|
Chemistry Techniques, Analytical
(1 time)
|
Con A (1 time)
ECL (1 time)
|
2015 Reusable and dual-potential responses electrogenerated chemiluminescence biosensor for synchronously cytosensing and dynamic cell surface N-glycan evaluation.
|
| 81 |
presence of the complex bpV
(1 time)
|
Chemistry
(1 time)
|
JNK (1 time)
MAPK (1 time)
|
1999 Activation of MAPK by potassium bisperoxo(1,10-phenanthroline)oxovanadate (V).
|
| 82 |
presence of the metal complex, cis-Rh
(1 time)
|
Biochemistry
(1 time)
|
MB (1 time)
|
2000 Simultaneous photoconjugation of methylene blue and cis-Rh(phen)2Cl2+ to DNA via a synergistic effect.
|
| 83 |
presence of the product Fe
(1 time)
|
Chemistry
(1 time)
|
---
|
2006 Kinetics of the reaction of chromium(VI) with tris(1,10-phenanthroline)iron(II) ions in acidic solutions. Anion and medium effects: perchlorate versus triflate.
|
| 84 |
present in endosomal subfractions not significantly inhibited by bpv
(1 time)
|
Endocrinology
(1 time)
|
EN (1 time)
IRK (1 time)
PTP (1 time)
|
2006 Insulin receptor kinase-associated phosphotyrosine phosphatases in hepatic endosomes: assessing the role of phosphotyrosine phosphatase-1B.
|
| 85 |
pressure and heart rate were significantly decreased by bpV
(1 time)
|
Pharmacology
(1 time)
|
PTEN (1 time)
|
2011 PTEN inhibitors cause a negative inotropic and chronotropic effect in mice.
|
| 86 |
Primer extension on the cis-Rh
(1 time)
|
Biochemistry
(1 time)
|
---
|
1999 Photoinduced cross-linking of RNA by cis-Rh(phen)2Cl2+ and cis-Rh(phen)(phi)Cl2+: a new family of light activatable nucleic acid cross-linking agents.
|
| 87 |
probed the cytophysiological mechanism of Cu
(1 time)
|
Biochemistry
(1 time)
|
---
|
2014 Probing the cell death signaling pathway of HepG2 cell line induced by copper-1,10-phenanthroline complex.
|
| 88 |
Probing Spin-State Switching in Fe
(1 time)
|
Nanotechnology
(1 time)
|
SCO (1 time)
|
2018 Probing Spin-State Switching in Fe(phen)₂(NCS)₂ Thin Film Nanocrystals on Different Substrates by Electrical Conductivity Measurements.
|
| 89 |
procedure, the Mn
(1 time)
|
Biochemistry
(1 time)
|
CV (1 time)
f-MWCNT (1 time)
GOx (1 time)
|
2020 Molecular wiring of glucose oxidase enzyme with Mn polypyridine complex on MWCNT modified electrode surface and its bio-electrocatalytic oxidation and glucose sensing.
|
| 90 |
produced an additive inhibitory effect on bpV
(1 time)
|
Biochemistry
(1 time)
|
GS (1 time)
GSK-3 (1 time)
|
1999 Regulation of glycogen synthase in rat hepatocytes. Evidence for multiple signaling pathways.
|
| 91 |
produced in the reaction between Ru
(1 time)
|
Biochemistry
(1 time)
|
CCD (1 time)
CL (1 time)
ENRO (1 time)
|
2008 Flow-injection chemiluminescence determination of enrofloxacin using the Ru(phen)3(2+)-Ce(IV) system and central composite design for the optimization of chemical variables.
|
| 92 |
products on the GO surface, then embedding Ru
(1 time)
|
Biotechnology
(1 time)
|
CP (1 time)
ECL (1 time)
GO (1 time)
|
2018 Ultrasensitive Faraday cage-type electrochemiluminescence assay for femtomolar miRNA-141 via graphene oxide and hybridization chain reaction-assisted cascade amplification.
|
| 93 |
promazine in human serum and drug formulations using Ru
(1 time)
|
Biochemistry
(1 time)
|
CL (1 time)
PMH (1 time)
|
2009 Chemiluminescence determination of promazine in human serum and drug formulations using Ru(phen)3(2+)-Ce(IV) system and a chemometrical optimization approach.
|
| 94 |
properties are identical to those of related
(1 time)
|
Chemistry
(1 time)
|
---
|
2008 General method for synthesis of functionalized macrocycles and catenanes utilizing "click" chemistry.
|
| 95 |
protection was further demonstrated by the incapacity of bpV
(1 time)
|
Allergy and Immunology
(1 time)
|
iNOS (1 time)
pV (1 time)
|
2000 Peroxovanadium-mediated protection against murine leishmaniasis: role of the modulation of nitric oxide.
|
| 96 |
protocol to furnish the porphyrin-Cu
(1 time)
|
Biochemistry
(1 time)
|
HETPHEN (1 time)
|
2007 Synthesis of supramolecular fullerene-porphyrin-Cu(phen)(2)-ferrocene architectures. A heteroleptic approach towards tetrads.
|
| 97 |
proved that the fluorescence quenching of BSA by Cu
(1 time)
|
Environmental Health
(1 time)
|
BSA (1 time)
CD (1 time)
|
2008 Study on the interaction between Cu phen2+3 and bovine serum albumin by spectroscopic methods.
|
| 98 |
provide evidence that the Fe
(1 time)
|
Biochemistry
(1 time)
|
---
|
2004 Reevaluating the role of 1,10-phenanthroline in oxidative reactions involving ferrous ions and DNA damage.
|
| 99 |
pseudohalide group (L(-)) and the metal center in Pt
(1 time)
|
Chemistry
(1 time)
|
---
|
2012 Platinum(II) diimine complexes with halide/pseudohalide ligands and dangling trialkylamine or ammonium groups.
|
| 100 |
PTEN inhibition by bpV
(1 time)
|
Pharmacology
(1 time)
|
OA (1 time)
PTEN (1 time)
TUNEL (1 time)
|
2009 Inhibition of the phosphatase PTEN protects mice against oleic acid-induced acute lung injury.
|
A Search Service for Abbreviation / Long Form